C22H16ClIN4O2 — CID 87748700
ethyl 2-chloro-5-[[3-cyano-4-(4-cyano-2-methylphenyl)-2-iodopyrrol-1-yl]methyl]pyridine-3-carboxylate (PubChem CID 87748700) has the molecular formula C22H16ClIN4O2 and a molecular weight of 530.75 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[3-cyano-4-(4-cyano-2-methylphenyl)-2-iodopyrrol-1-yl]methyl]pyridine-3-carboxylate.
| Compound Name | ethyl 2-chloro-5-[[3-cyano-4-(4-cyano-2-methylphenyl)-2-iodopyrrol-1-yl]methyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 87748700 |
| Molecular Formula | C22H16ClIN4O2 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.00 |
| IUPAC Name | ethyl 2-chloro-5-[[3-cyano-4-(4-cyano-2-methylphenyl)-2-iodopyrrol-1-yl]methyl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(Cn2cc(-c3ccc(C#N)cc3C)c(C#N)c2I)cnc1Cl |
| InChI | InChI=1S/C22H16ClIN4O2/c1-3-30-22(29)17-7-15(10-27-20(17)23)11-28-12-19(18(9-26)21(28)24)16-5-4-14(8-25)6-13(16)2/h4-7,10,12H,3,11H2,1-2H3 |
| InChIKey | CXPUUVLUOWNJLW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 91.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|