C27H37Cl2N5O8 — CID 161430684
ethyl 5-(aminomethyl)-2-chloropyridine-3-carboxylate;ethyl 2-chloro-5-pyrazol-1-ylpyridine-3-carboxylate;1,1,3,3-tetramethoxypropane (PubChem CID 161430684) has the molecular formula C27H37Cl2N5O8 and a molecular weight of 630.53 g/mol. Its IUPAC name is ethyl 5-(aminomethyl)-2-chloropyridine-3-carboxylate;ethyl 2-chloro-5-pyrazol-1-ylpyridine-3-carboxylate;1,1,3,3-tetramethoxypropane.
| Compound Name | ethyl 5-(aminomethyl)-2-chloropyridine-3-carboxylate;ethyl 2-chloro-5-pyrazol-1-ylpyridine-3-carboxylate;1,1,3,3-tetramethoxypropane |
|---|---|
| PubChem CID | 161430684 |
| Molecular Formula | C27H37Cl2N5O8 |
| Molecular Weight | 630.53 g/mol |
| Exact Mass | 629.20 |
| IUPAC Name | ethyl 5-(aminomethyl)-2-chloropyridine-3-carboxylate;ethyl 2-chloro-5-pyrazol-1-ylpyridine-3-carboxylate;1,1,3,3-tetramethoxypropane |
| SMILES | CCOC(=O)c1cc(-n2cccn2)cnc1Cl.CCOC(=O)c1cc(CN)cnc1Cl.COC(CC(OC)OC)OC |
| InChI | InChI=1S/C11H10ClN3O2.C9H11ClN2O2.C7H16O4/c1-2-17-11(16)9-6-8(7-13-10(9)12)15-5-3-4-14-15;1-2-14-9(13)7-3-6(4-11)5-12-8(7)10;1-8-6(9-2)5-7(10-3)11-4/h3-7H,2H2,1H3;3,5H,2,4,11H2,1H3;6-7H,5H2,1-4H3 |
| InChIKey | VXYUJMXKELLCTB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 159.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|