C26H25Cl2F2IN2O4 — CID 146493865
2-[1-[2,4-dichloro-3-[[6-[difluoro(iodo)methoxy]-1,4-dimethylindol-3-yl]methyl]benzoyl]piperidin-4-yl]acetic acid (PubChem CID 146493865) has the molecular formula C26H25Cl2F2IN2O4 and a molecular weight of 665.30 g/mol. Its IUPAC name is 2-[1-[2,4-dichloro-3-[[6-[difluoro(iodo)methoxy]-1,4-dimethylindol-3-yl]methyl]benzoyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[2,4-dichloro-3-[[6-[difluoro(iodo)methoxy]-1,4-dimethylindol-3-yl]methyl]benzoyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 146493865 |
| Molecular Formula | C26H25Cl2F2IN2O4 |
| Molecular Weight | 665.30 g/mol |
| Exact Mass | 664.02 |
| IUPAC Name | 2-[1-[2,4-dichloro-3-[[6-[difluoro(iodo)methoxy]-1,4-dimethylindol-3-yl]methyl]benzoyl]piperidin-4-yl]acetic acid |
| SMILES | Cc1cc(OC(F)(F)I)cc2c1c(Cc1c(Cl)ccc(C(=O)N3CCC(CC(=O)O)CC3)c1Cl)cn2C |
| InChI | InChI=1S/C26H25Cl2F2IN2O4/c1-14-9-17(37-26(29,30)31)12-21-23(14)16(13-32(21)2)11-19-20(27)4-3-18(24(19)28)25(36)33-7-5-15(6-8-33)10-22(34)35/h3-4,9,12-13,15H,5-8,10-11H2,1-2H3,(H,34,35) |
| InChIKey | COEJFFCYPABREI-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.30 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|