C20H22O4 — CID 146494272
2-[2-(1,3-benzodioxol-5-yl)propyl]-4-propan-2-yl-1,3-benzodioxole (PubChem CID 146494272) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)propyl]-4-propan-2-yl-1,3-benzodioxole.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)propyl]-4-propan-2-yl-1,3-benzodioxole |
|---|---|
| PubChem CID | 146494272 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)propyl]-4-propan-2-yl-1,3-benzodioxole |
| SMILES | CC(C)c1cccc2c1OC(CC(C)c1ccc3c(c1)OCO3)O2 |
| InChI | InChI=1S/C20H22O4/c1-12(2)15-5-4-6-17-20(15)24-19(23-17)9-13(3)14-7-8-16-18(10-14)22-11-21-16/h4-8,10,12-13,19H,9,11H2,1-3H3 |
| InChIKey | JRWXVRYINJNHOP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |