C19H18ClF2N3O2S — CID 146496060
2-chloro-N-(3,4-difluorophenyl)-1-[(3-methyloxetan-3-yl)amino]sulfanyl-5,6-dihydroindolizine-3-carboxamide (PubChem CID 146496060) has the molecular formula C19H18ClF2N3O2S and a molecular weight of 425.89 g/mol. Its IUPAC name is 2-chloro-N-(3,4-difluorophenyl)-1-[(3-methyloxetan-3-yl)amino]sulfanyl-5,6-dihydroindolizine-3-carboxamide.
| Compound Name | 2-chloro-N-(3,4-difluorophenyl)-1-[(3-methyloxetan-3-yl)amino]sulfanyl-5,6-dihydroindolizine-3-carboxamide |
|---|---|
| PubChem CID | 146496060 |
| Molecular Formula | C19H18ClF2N3O2S |
| Molecular Weight | 425.89 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 2-chloro-N-(3,4-difluorophenyl)-1-[(3-methyloxetan-3-yl)amino]sulfanyl-5,6-dihydroindolizine-3-carboxamide |
| SMILES | CC1(NSc2c(Cl)c(C(=O)Nc3ccc(F)c(F)c3)n3c2C=CCC3)COC1 |
| InChI | InChI=1S/C19H18ClF2N3O2S/c1-19(9-27-10-19)24-28-17-14-4-2-3-7-25(14)16(15(17)20)18(26)23-11-5-6-12(21)13(22)8-11/h2,4-6,8,24H,3,7,9-10H2,1H3,(H,23,26) |
| InChIKey | RKDOCQZBNHTPTM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.89 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|