C19H18F2N4O2S — CID 146496350
N-(3,4-difluorophenyl)-6-methyl-7-[(3-methyloxetan-3-yl)amino]sulfanylpyrrolo[3,4-b]pyridine-5-carboxamide (PubChem CID 146496350) has the molecular formula C19H18F2N4O2S and a molecular weight of 404.44 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-6-methyl-7-[(3-methyloxetan-3-yl)amino]sulfanylpyrrolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-6-methyl-7-[(3-methyloxetan-3-yl)amino]sulfanylpyrrolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 146496350 |
| Molecular Formula | C19H18F2N4O2S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-(3,4-difluorophenyl)-6-methyl-7-[(3-methyloxetan-3-yl)amino]sulfanylpyrrolo[3,4-b]pyridine-5-carboxamide |
| SMILES | Cn1c(C(=O)Nc2ccc(F)c(F)c2)c2cccnc2c1SNC1(C)COC1 |
| InChI | InChI=1S/C19H18F2N4O2S/c1-19(9-27-10-19)24-28-18-15-12(4-3-7-22-15)16(25(18)2)17(26)23-11-5-6-13(20)14(21)8-11/h3-8,24H,9-10H2,1-2H3,(H,23,26) |
| InChIKey | FFPWJWDZAHKEOV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|