C18H20FN3O4S — CID 146499759
6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-7-fluoro-3-[(5R)-5-methyl-2-oxo-1,3-thiazolidin-3-yl]-1,2-benzoxazole-5-carbaldehyde (PubChem CID 146499759) has the molecular formula C18H20FN3O4S and a molecular weight of 393.44 g/mol. Its IUPAC name is 6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-7-fluoro-3-[(5R)-5-methyl-2-oxo-1,3-thiazolidin-3-yl]-1,2-benzoxazole-5-carbaldehyde.
| Compound Name | 6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-7-fluoro-3-[(5R)-5-methyl-2-oxo-1,3-thiazolidin-3-yl]-1,2-benzoxazole-5-carbaldehyde |
|---|---|
| PubChem CID | 146499759 |
| Molecular Formula | C18H20FN3O4S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-7-fluoro-3-[(5R)-5-methyl-2-oxo-1,3-thiazolidin-3-yl]-1,2-benzoxazole-5-carbaldehyde |
| SMILES | C[C@@H]1CN(c2c(C=O)cc3c(N4C[C@@H](C)SC4=O)noc3c2F)C[C@@H](C)O1 |
| InChI | InChI=1S/C18H20FN3O4S/c1-9-5-21(6-10(2)25-9)15-12(8-23)4-13-16(14(15)19)26-20-17(13)22-7-11(3)27-18(22)24/h4,8-11H,5-7H2,1-3H3/t9-,10-,11-/m1/s1 |
| InChIKey | GHXIETMJAFJJAH-GMTAPVOTSA-N |
| XLogP | 3.45 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|