C24H23FN2O4S — CID 156654739
6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-7-fluoro-3-[(5S)-2-oxo-5-phenyl-1,3-thiazolidin-3-yl]-1-benzofuran-5-carbaldehyde (PubChem CID 156654739) has the molecular formula C24H23FN2O4S and a molecular weight of 454.52 g/mol. Its IUPAC name is 6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-7-fluoro-3-[(5S)-2-oxo-5-phenyl-1,3-thiazolidin-3-yl]-1-benzofuran-5-carbaldehyde.
| Compound Name | 6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-7-fluoro-3-[(5S)-2-oxo-5-phenyl-1,3-thiazolidin-3-yl]-1-benzofuran-5-carbaldehyde |
|---|---|
| PubChem CID | 156654739 |
| Molecular Formula | C24H23FN2O4S |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-7-fluoro-3-[(5S)-2-oxo-5-phenyl-1,3-thiazolidin-3-yl]-1-benzofuran-5-carbaldehyde |
| SMILES | C[C@@H]1CN(c2c(C=O)cc3c(N4C[C@H](c5ccccc5)SC4=O)coc3c2F)C[C@@H](C)O1 |
| InChI | InChI=1S/C24H23FN2O4S/c1-14-9-26(10-15(2)31-14)22-17(12-28)8-18-19(13-30-23(18)21(22)25)27-11-20(32-24(27)29)16-6-4-3-5-7-16/h3-8,12-15,20H,9-11H2,1-2H3/t14-,15-,20-/m1/s1 |
| InChIKey | MWUHOGXQCJOVRO-STXHMFSFSA-N |
| XLogP | 5.41 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|