C15H15F2N3O2S — CID 87772207
2-(2,6-dimethylmorpholin-4-yl)-3,4-difluoro-5-(1,3,4-thiadiazol-2-yl)benzaldehyde (PubChem CID 87772207) has the molecular formula C15H15F2N3O2S and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)-3,4-difluoro-5-(1,3,4-thiadiazol-2-yl)benzaldehyde.
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)-3,4-difluoro-5-(1,3,4-thiadiazol-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 87772207 |
| Molecular Formula | C15H15F2N3O2S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)-3,4-difluoro-5-(1,3,4-thiadiazol-2-yl)benzaldehyde |
| SMILES | CC1CN(c2c(C=O)cc(-c3nncs3)c(F)c2F)CC(C)O1 |
| InChI | InChI=1S/C15H15F2N3O2S/c1-8-4-20(5-9(2)22-8)14-10(6-21)3-11(12(16)13(14)17)15-19-18-7-23-15/h3,6-9H,4-5H2,1-2H3 |
| InChIKey | CONDKSYOQOVYKV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|