C19H18FNO2S — CID 86646530
2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-fluoro-5-(2-thiophen-2-ylethynyl)benzaldehyde (PubChem CID 86646530) has the molecular formula C19H18FNO2S and a molecular weight of 343.42 g/mol. Its IUPAC name is 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-fluoro-5-(2-thiophen-2-ylethynyl)benzaldehyde.
| Compound Name | 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-fluoro-5-(2-thiophen-2-ylethynyl)benzaldehyde |
|---|---|
| PubChem CID | 86646530 |
| Molecular Formula | C19H18FNO2S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-fluoro-5-(2-thiophen-2-ylethynyl)benzaldehyde |
| SMILES | C[C@@H]1CN(c2c(F)cc(C#Cc3cccs3)cc2C=O)C[C@H](C)O1 |
| InChI | InChI=1S/C19H18FNO2S/c1-13-10-21(11-14(2)23-13)19-16(12-22)8-15(9-18(19)20)5-6-17-4-3-7-24-17/h3-4,7-9,12-14H,10-11H2,1-2H3/t13-,14+ |
| InChIKey | UMXXXOOWZBJRGQ-OKILXGFUSA-N |
| XLogP | 3.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|