C15H17FN2O4 — CID 87368817
6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-7-fluoro-2-methyl-3-oxo-1,2-benzoxazole-5-carbaldehyde (PubChem CID 87368817) has the molecular formula C15H17FN2O4 and a molecular weight of 308.31 g/mol. Its IUPAC name is 6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-7-fluoro-2-methyl-3-oxo-1,2-benzoxazole-5-carbaldehyde.
| Compound Name | 6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-7-fluoro-2-methyl-3-oxo-1,2-benzoxazole-5-carbaldehyde |
|---|---|
| PubChem CID | 87368817 |
| Molecular Formula | C15H17FN2O4 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-7-fluoro-2-methyl-3-oxo-1,2-benzoxazole-5-carbaldehyde |
| SMILES | C[C@@H]1CN(c2c(C=O)cc3c(=O)n(C)oc3c2F)C[C@H](C)O1 |
| InChI | InChI=1S/C15H17FN2O4/c1-8-5-18(6-9(2)21-8)13-10(7-19)4-11-14(12(13)16)22-17(3)15(11)20/h4,7-9H,5-6H2,1-3H3/t8-,9+ |
| InChIKey | QFCWCKDICWPQLQ-DTORHVGOSA-N |
| XLogP | 1.70 |
| TPSA | 64.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|