C16H19F2NO4 — CID 91525109
3-[4-(2,6-dimethylmorpholin-4-yl)-2,3-difluoro-5-formylphenyl]propanoic acid (PubChem CID 91525109) has the molecular formula C16H19F2NO4 and a molecular weight of 327.33 g/mol. Its IUPAC name is 3-[4-(2,6-dimethylmorpholin-4-yl)-2,3-difluoro-5-formylphenyl]propanoic acid.
| Compound Name | 3-[4-(2,6-dimethylmorpholin-4-yl)-2,3-difluoro-5-formylphenyl]propanoic acid |
|---|---|
| PubChem CID | 91525109 |
| Molecular Formula | C16H19F2NO4 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 3-[4-(2,6-dimethylmorpholin-4-yl)-2,3-difluoro-5-formylphenyl]propanoic acid |
| SMILES | CC1CN(c2c(C=O)cc(CCC(=O)O)c(F)c2F)CC(C)O1 |
| InChI | InChI=1S/C16H19F2NO4/c1-9-6-19(7-10(2)23-9)16-12(8-20)5-11(3-4-13(21)22)14(17)15(16)18/h5,8-10H,3-4,6-7H2,1-2H3,(H,21,22) |
| InChIKey | GMEYYHOQZFUPJH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|