C25H19ClN2O3 — CID 146504363
N-(4-chlorophenyl)-2-[(1,4-dioxonaphthalen-2-yl)amino]-3-phenylpropanamide (PubChem CID 146504363) has the molecular formula C25H19ClN2O3 and a molecular weight of 430.89 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(1,4-dioxonaphthalen-2-yl)amino]-3-phenylpropanamide.
| Compound Name | N-(4-chlorophenyl)-2-[(1,4-dioxonaphthalen-2-yl)amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 146504363 |
| Molecular Formula | C25H19ClN2O3 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(1,4-dioxonaphthalen-2-yl)amino]-3-phenylpropanamide |
| SMILES | O=C1C=C(NC(Cc2ccccc2)C(=O)Nc2ccc(Cl)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C25H19ClN2O3/c26-17-10-12-18(13-11-17)27-25(31)22(14-16-6-2-1-3-7-16)28-21-15-23(29)19-8-4-5-9-20(19)24(21)30/h1-13,15,22,28H,14H2,(H,27,31) |
| InChIKey | KFZWPBMLBZAOAI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|