C27H24N2O3 — CID 175111130
N-(3,5-dimethylphenyl)-2-[(1,4-dioxonaphthalen-2-yl)amino]-3-phenylpropanamide (PubChem CID 175111130) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[(1,4-dioxonaphthalen-2-yl)amino]-3-phenylpropanamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[(1,4-dioxonaphthalen-2-yl)amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 175111130 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[(1,4-dioxonaphthalen-2-yl)amino]-3-phenylpropanamide |
| SMILES | Cc1cc(C)cc(NC(=O)C(Cc2ccccc2)NC2=CC(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C27H24N2O3/c1-17-12-18(2)14-20(13-17)28-27(32)24(15-19-8-4-3-5-9-19)29-23-16-25(30)21-10-6-7-11-22(21)26(23)31/h3-14,16,24,29H,15H2,1-2H3,(H,28,32) |
| InChIKey | RUDZIUXQVYQGNJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|