C25H18BrFN2O3 — CID 175112988
N-(4-bromo-3-fluorophenyl)-2-[(1,4-dioxonaphthalen-2-yl)amino]-3-phenylpropanamide (PubChem CID 175112988) has the molecular formula C25H18BrFN2O3 and a molecular weight of 493.33 g/mol. Its IUPAC name is N-(4-bromo-3-fluorophenyl)-2-[(1,4-dioxonaphthalen-2-yl)amino]-3-phenylpropanamide.
| Compound Name | N-(4-bromo-3-fluorophenyl)-2-[(1,4-dioxonaphthalen-2-yl)amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 175112988 |
| Molecular Formula | C25H18BrFN2O3 |
| Molecular Weight | 493.33 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | N-(4-bromo-3-fluorophenyl)-2-[(1,4-dioxonaphthalen-2-yl)amino]-3-phenylpropanamide |
| SMILES | O=C1C=C(NC(Cc2ccccc2)C(=O)Nc2ccc(Br)c(F)c2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C25H18BrFN2O3/c26-19-11-10-16(13-20(19)27)28-25(32)22(12-15-6-2-1-3-7-15)29-21-14-23(30)17-8-4-5-9-18(17)24(21)31/h1-11,13-14,22,29H,12H2,(H,28,32) |
| InChIKey | PVDAEPMAEANBJT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|