About 4-cyclohexylsulfanyl-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile
4-cyclohexylsulfanyl-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile (PubChem CID 14650545) has the molecular formula C18H23NO2S
and a molecular weight of 317.45 g/mol. Its IUPAC name is 4-cyclohexylsulfanyl-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile.
Molecular Properties
| Compound Name | 4-cyclohexylsulfanyl-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile |
| PubChem CID | 14650545 |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 4-cyclohexylsulfanyl-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile |
| SMILES | CC1(C)Oc2ccc(C#N)cc2C(SC2CCCCC2)C1O |
| InChI | InChI=1S/C18H23NO2S/c1-18(2)17(20)16(22-13-6-4-3-5-7-13)14-10-12(11-19)8-9-15(14)21-18/h8-10,13,16-17,20H,3-7H2,1-2H3 |
| InChIKey | OLAYEQGZSMAGOG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-cyclohexylsulfanyl-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylsulfanyl-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile?
The IUPAC name of 4-cyclohexylsulfanyl-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile (CID 14650545) is 4-cyclohexylsulfanyl-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile.
What is the SMILES notation for 4-cyclohexylsulfanyl-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile?
The canonical SMILES for 4-cyclohexylsulfanyl-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile is CC1(C)Oc2ccc(C#N)cc2C(SC2CCCCC2)C1O.
What is the InChIKey of 4-cyclohexylsulfanyl-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile?
The InChIKey is OLAYEQGZSMAGOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO2S/c1-18(2)17(20)16(22-13-6-4-3-5-7-13)14-10-12(11-19)8-9-15(14)21-18/h8-10,13,16-17,20H,3-7H2,1-2H3.
What are the key properties of 4-cyclohexylsulfanyl-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile?
4-cyclohexylsulfanyl-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile has a molecular weight of 317.45 g/mol, XLogP of 4.20, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylsulfanyl-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile is sourced from PubChem (CID 14650545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).