C19H26N2O — CID 146507436
4-(3-amino-N-(2,4,6-trimethylphenyl)anilino)butan-1-ol (PubChem CID 146507436) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 4-(3-amino-N-(2,4,6-trimethylphenyl)anilino)butan-1-ol.
| Compound Name | 4-(3-amino-N-(2,4,6-trimethylphenyl)anilino)butan-1-ol |
|---|---|
| PubChem CID | 146507436 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 4-(3-amino-N-(2,4,6-trimethylphenyl)anilino)butan-1-ol |
| SMILES | Cc1cc(C)c(N(CCCCO)c2cccc(N)c2)c(C)c1 |
| InChI | InChI=1S/C19H26N2O/c1-14-11-15(2)19(16(3)12-14)21(9-4-5-10-22)18-8-6-7-17(20)13-18/h6-8,11-13,22H,4-5,9-10,20H2,1-3H3 |
| InChIKey | GURYRTRWGITHFI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|