C11H13N4O7P — CID 146511163
[(1R,4R)-4-(5-amino-7-oxoimidazo[4,5-d][1,3]oxazin-3-yl)-2-oxocyclopentyl]methyl dihydrogen phosphate (PubChem CID 146511163) has the molecular formula C11H13N4O7P and a molecular weight of 344.22 g/mol. Its IUPAC name is [(1R,4R)-4-(5-amino-7-oxoimidazo[4,5-d][1,3]oxazin-3-yl)-2-oxocyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [(1R,4R)-4-(5-amino-7-oxoimidazo[4,5-d][1,3]oxazin-3-yl)-2-oxocyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 146511163 |
| Molecular Formula | C11H13N4O7P |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | [(1R,4R)-4-(5-amino-7-oxoimidazo[4,5-d][1,3]oxazin-3-yl)-2-oxocyclopentyl]methyl dihydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@H]2CC(=O)[C@@H](COP(=O)(O)O)C2)c(=O)o1 |
| InChI | InChI=1S/C11H13N4O7P/c12-11-14-9-8(10(17)22-11)13-4-15(9)6-1-5(7(16)2-6)3-21-23(18,19)20/h4-6H,1-3H2,(H2,12,14)(H2,18,19,20)/t5-,6-/m1/s1 |
| InChIKey | BQTGFTPZSQKQKT-PHDIDXHHSA-N |
| XLogP | -0.40 |
| TPSA | 170.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|