C22H21F3N6O — CID 146515522
[5-amino-4-[N-methyl-C-(3,4,5-trifluorophenyl)carbonimidoyl]-3,6-dihydro-2H-pyridin-1-yl]-(2,8-dimethylimidazo[1,2-b]pyridazin-3-yl)methanone (PubChem CID 146515522) has the molecular formula C22H21F3N6O and a molecular weight of 442.45 g/mol. Its IUPAC name is [5-amino-4-[N-methyl-C-(3,4,5-trifluorophenyl)carbonimidoyl]-3,6-dihydro-2H-pyridin-1-yl]-(2,8-dimethylimidazo[1,2-b]pyridazin-3-yl)methanone.
| Compound Name | [5-amino-4-[N-methyl-C-(3,4,5-trifluorophenyl)carbonimidoyl]-3,6-dihydro-2H-pyridin-1-yl]-(2,8-dimethylimidazo[1,2-b]pyridazin-3-yl)methanone |
|---|---|
| PubChem CID | 146515522 |
| Molecular Formula | C22H21F3N6O |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | [5-amino-4-[N-methyl-C-(3,4,5-trifluorophenyl)carbonimidoyl]-3,6-dihydro-2H-pyridin-1-yl]-(2,8-dimethylimidazo[1,2-b]pyridazin-3-yl)methanone |
| SMILES | C/N=C(/C1=C(N)CN(C(=O)c2c(C)nc3c(C)ccnn23)CC1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C22H21F3N6O/c1-11-4-6-28-31-20(12(2)29-21(11)31)22(32)30-7-5-14(17(26)10-30)19(27-3)13-8-15(23)18(25)16(24)9-13/h4,6,8-9H,5,7,10,26H2,1-3H3/b27-19+ |
| InChIKey | GYMIGANVOCVJQA-ZXVVBBHZSA-N |
| XLogP | 2.94 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|