C22H21F4N5O — CID 146515608
[5-amino-4-[N-methyl-C-(3,4,5-trifluorophenyl)carbonimidoyl]-3,6-dihydro-2H-pyridin-1-yl]-(6-fluoro-2-methyl-1,8a-dihydroimidazo[1,2-a]pyridin-3-yl)methanone (PubChem CID 146515608) has the molecular formula C22H21F4N5O and a molecular weight of 447.44 g/mol. Its IUPAC name is [5-amino-4-[N-methyl-C-(3,4,5-trifluorophenyl)carbonimidoyl]-3,6-dihydro-2H-pyridin-1-yl]-(6-fluoro-2-methyl-1,8a-dihydroimidazo[1,2-a]pyridin-3-yl)methanone.
| Compound Name | [5-amino-4-[N-methyl-C-(3,4,5-trifluorophenyl)carbonimidoyl]-3,6-dihydro-2H-pyridin-1-yl]-(6-fluoro-2-methyl-1,8a-dihydroimidazo[1,2-a]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 146515608 |
| Molecular Formula | C22H21F4N5O |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | [5-amino-4-[N-methyl-C-(3,4,5-trifluorophenyl)carbonimidoyl]-3,6-dihydro-2H-pyridin-1-yl]-(6-fluoro-2-methyl-1,8a-dihydroimidazo[1,2-a]pyridin-3-yl)methanone |
| SMILES | C/N=C(/C1=C(N)CN(C(=O)C2=C(C)NC3C=CC(F)=CN23)CC1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C22H21F4N5O/c1-11-21(31-9-13(23)3-4-18(31)29-11)22(32)30-6-5-14(17(27)10-30)20(28-2)12-7-15(24)19(26)16(25)8-12/h3-4,7-9,18,29H,5-6,10,27H2,1-2H3/b28-20+ |
| InChIKey | SZTWEMVMIJPBIR-VFCFBJKWSA-N |
| XLogP | 2.81 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|