C20H15F3N6O — CID 146515629
[2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-(1H-pyrazolo[3,4-b]pyridin-4-yl)methanone (PubChem CID 146515629) has the molecular formula C20H15F3N6O and a molecular weight of 412.38 g/mol. Its IUPAC name is [2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-(1H-pyrazolo[3,4-b]pyridin-4-yl)methanone.
| Compound Name | [2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-(1H-pyrazolo[3,4-b]pyridin-4-yl)methanone |
|---|---|
| PubChem CID | 146515629 |
| Molecular Formula | C20H15F3N6O |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-(1H-pyrazolo[3,4-b]pyridin-4-yl)methanone |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)CCN(C(=O)c1ccnc3[nH]ncc13)C2 |
| InChI | InChI=1S/C20H15F3N6O/c1-28-18(10-6-14(21)17(23)15(22)7-10)12-3-5-29(9-16(12)27-28)20(30)11-2-4-24-19-13(11)8-25-26-19/h2,4,6-8H,3,5,9H2,1H3,(H,24,25,26) |
| InChIKey | UUKPAHUYAQJLSV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|