C22H19F3N4O2 — CID 146515949
3,4-dihydro-2H-pyrano[3,2-b]pyridin-8-yl-[2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]methanone (PubChem CID 146515949) has the molecular formula C22H19F3N4O2 and a molecular weight of 428.41 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyrano[3,2-b]pyridin-8-yl-[2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]methanone.
| Compound Name | 3,4-dihydro-2H-pyrano[3,2-b]pyridin-8-yl-[2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]methanone |
|---|---|
| PubChem CID | 146515949 |
| Molecular Formula | C22H19F3N4O2 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 3,4-dihydro-2H-pyrano[3,2-b]pyridin-8-yl-[2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]methanone |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)CCN(C(=O)c1ccnc3c1OCCC3)C2 |
| InChI | InChI=1S/C22H19F3N4O2/c1-28-20(12-9-15(23)19(25)16(24)10-12)13-5-7-29(11-18(13)27-28)22(30)14-4-6-26-17-3-2-8-31-21(14)17/h4,6,9-10H,2-3,5,7-8,11H2,1H3 |
| InChIKey | SLVKIDBNXNDYTA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|