C24H36N2S — CID 146516060
(1S)-N-methyl-1-phenyl-N'-[2,4,6-tri(propan-2-yl)phenyl]sulfanylethane-1,2-diamine (PubChem CID 146516060) has the molecular formula C24H36N2S and a molecular weight of 384.63 g/mol. Its IUPAC name is (1S)-N-methyl-1-phenyl-N'-[2,4,6-tri(propan-2-yl)phenyl]sulfanylethane-1,2-diamine.
| Compound Name | (1S)-N-methyl-1-phenyl-N'-[2,4,6-tri(propan-2-yl)phenyl]sulfanylethane-1,2-diamine |
|---|---|
| PubChem CID | 146516060 |
| Molecular Formula | C24H36N2S |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | (1S)-N-methyl-1-phenyl-N'-[2,4,6-tri(propan-2-yl)phenyl]sulfanylethane-1,2-diamine |
| SMILES | CN[C@H](CNSc1c(C(C)C)cc(C(C)C)cc1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H36N2S/c1-16(2)20-13-21(17(3)4)24(22(14-20)18(5)6)27-26-15-23(25-7)19-11-9-8-10-12-19/h8-14,16-18,23,25-26H,15H2,1-7H3/t23-/m1/s1 |
| InChIKey | DXQXRLQAYGCQAY-HSZRJFAPSA-N |
| XLogP | 6.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|