C22H27BrFN3O2 — CID 146517867
1-(4-bromo-2-methoxyphenyl)-2-(2-fluoro-3-methoxy-2-methylpropyl)-5-methanimidoyl-3,4-dihydro-1H-isoquinolin-6-amine (PubChem CID 146517867) has the molecular formula C22H27BrFN3O2 and a molecular weight of 464.38 g/mol. Its IUPAC name is 1-(4-bromo-2-methoxyphenyl)-2-(2-fluoro-3-methoxy-2-methylpropyl)-5-methanimidoyl-3,4-dihydro-1H-isoquinolin-6-amine.
| Compound Name | 1-(4-bromo-2-methoxyphenyl)-2-(2-fluoro-3-methoxy-2-methylpropyl)-5-methanimidoyl-3,4-dihydro-1H-isoquinolin-6-amine |
|---|---|
| PubChem CID | 146517867 |
| Molecular Formula | C22H27BrFN3O2 |
| Molecular Weight | 464.38 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 1-(4-bromo-2-methoxyphenyl)-2-(2-fluoro-3-methoxy-2-methylpropyl)-5-methanimidoyl-3,4-dihydro-1H-isoquinolin-6-amine |
| SMILES | [H]/N=C/c1c(N)ccc2c1CCN(CC(C)(F)COC)C2c1ccc(Br)cc1OC |
| InChI | InChI=1S/C22H27BrFN3O2/c1-22(24,13-28-2)12-27-9-8-15-16(6-7-19(26)18(15)11-25)21(27)17-5-4-14(23)10-20(17)29-3/h4-7,10-11,21,25H,8-9,12-13,26H2,1-3H3/b25-11+ |
| InChIKey | RGULFWNKSBAJSW-OPEKNORGSA-N |
| XLogP | 4.36 |
| TPSA | 71.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|