C20H22BrF3N2O — CID 140865876
(1R,3R)-1-(4-bromo-2-methoxyphenyl)-3,5-dimethyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-6-amine (PubChem CID 140865876) has the molecular formula C20H22BrF3N2O and a molecular weight of 443.31 g/mol. Its IUPAC name is (1R,3R)-1-(4-bromo-2-methoxyphenyl)-3,5-dimethyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-6-amine.
| Compound Name | (1R,3R)-1-(4-bromo-2-methoxyphenyl)-3,5-dimethyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-6-amine |
|---|---|
| PubChem CID | 140865876 |
| Molecular Formula | C20H22BrF3N2O |
| Molecular Weight | 443.31 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | (1R,3R)-1-(4-bromo-2-methoxyphenyl)-3,5-dimethyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-6-amine |
| SMILES | COc1cc(Br)ccc1[C@H]1c2ccc(N)c(C)c2C[C@@H](C)N1CC(F)(F)F |
| InChI | InChI=1S/C20H22BrF3N2O/c1-11-8-16-12(2)17(25)7-6-14(16)19(26(11)10-20(22,23)24)15-5-4-13(21)9-18(15)27-3/h4-7,9,11,19H,8,10,25H2,1-3H3/t11-,19-/m1/s1 |
| InChIKey | DJLWMKHJEGDXST-NSPYISDASA-N |
| XLogP | 5.25 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.31 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|