C18H15BrF6N2 — CID 166473229
(1S,3R)-1-(4-bromo-2,6-difluorophenyl)-5-fluoro-3-methyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-6-amine (PubChem CID 166473229) has the molecular formula C18H15BrF6N2 and a molecular weight of 453.22 g/mol. Its IUPAC name is (1S,3R)-1-(4-bromo-2,6-difluorophenyl)-5-fluoro-3-methyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-6-amine.
| Compound Name | (1S,3R)-1-(4-bromo-2,6-difluorophenyl)-5-fluoro-3-methyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-6-amine |
|---|---|
| PubChem CID | 166473229 |
| Molecular Formula | C18H15BrF6N2 |
| Molecular Weight | 453.22 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | (1S,3R)-1-(4-bromo-2,6-difluorophenyl)-5-fluoro-3-methyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-6-amine |
| SMILES | C[C@@H]1Cc2c(ccc(N)c2F)[C@@H](c2c(F)cc(Br)cc2F)N1CC(F)(F)F |
| InChI | InChI=1S/C18H15BrF6N2/c1-8-4-11-10(2-3-14(26)16(11)22)17(27(8)7-18(23,24)25)15-12(20)5-9(19)6-13(15)21/h2-3,5-6,8,17H,4,7,26H2,1H3/t8-,17+/m1/s1 |
| InChIKey | MIJWCDKTAQMPOO-RBHXEPJQSA-N |
| XLogP | 5.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.22 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|