C22H21F5N4O2 — CID 165124102
(6S,8R)-6-[4-(azetidin-3-ylamino)-2,6-difluorophenyl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydro-[1,3]oxazolo[5,4-f]isoquinolin-2-one (PubChem CID 165124102) has the molecular formula C22H21F5N4O2 and a molecular weight of 468.43 g/mol. Its IUPAC name is (6S,8R)-6-[4-(azetidin-3-ylamino)-2,6-difluorophenyl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydro-[1,3]oxazolo[5,4-f]isoquinolin-2-one.
| Compound Name | (6S,8R)-6-[4-(azetidin-3-ylamino)-2,6-difluorophenyl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydro-[1,3]oxazolo[5,4-f]isoquinolin-2-one |
|---|---|
| PubChem CID | 165124102 |
| Molecular Formula | C22H21F5N4O2 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | (6S,8R)-6-[4-(azetidin-3-ylamino)-2,6-difluorophenyl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydro-[1,3]oxazolo[5,4-f]isoquinolin-2-one |
| SMILES | C[C@@H]1Cc2c(ccc3[nH]c(=O)oc23)[C@@H](c2c(F)cc(NC3CNC3)cc2F)N1CC(F)(F)F |
| InChI | InChI=1S/C22H21F5N4O2/c1-10-4-14-13(2-3-17-20(14)33-21(32)30-17)19(31(10)9-22(25,26)27)18-15(23)5-11(6-16(18)24)29-12-7-28-8-12/h2-3,5-6,10,12,19,28-29H,4,7-9H2,1H3,(H,30,32)/t10-,19+/m1/s1 |
| InChIKey | MUGHAIJONDZTLK-DGIBIBHMSA-N |
| XLogP | 3.68 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |