C26H26F6N4O2 — CID 170692321
(6S,8R)-6-[2,6-difluoro-4-[6-(2-fluoroethyl)-2,6-diazaspiro[3.3]heptan-2-yl]phenyl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydro-[1,3]oxazolo[5,4-f]isoquinolin-2-one (PubChem CID 170692321) has the molecular formula C26H26F6N4O2 and a molecular weight of 540.51 g/mol. Its IUPAC name is (6S,8R)-6-[2,6-difluoro-4-[6-(2-fluoroethyl)-2,6-diazaspiro[3.3]heptan-2-yl]phenyl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydro-[1,3]oxazolo[5,4-f]isoquinolin-2-one.
| Compound Name | (6S,8R)-6-[2,6-difluoro-4-[6-(2-fluoroethyl)-2,6-diazaspiro[3.3]heptan-2-yl]phenyl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydro-[1,3]oxazolo[5,4-f]isoquinolin-2-one |
|---|---|
| PubChem CID | 170692321 |
| Molecular Formula | C26H26F6N4O2 |
| Molecular Weight | 540.51 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | (6S,8R)-6-[2,6-difluoro-4-[6-(2-fluoroethyl)-2,6-diazaspiro[3.3]heptan-2-yl]phenyl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydro-[1,3]oxazolo[5,4-f]isoquinolin-2-one |
| SMILES | C[C@@H]1Cc2c(ccc3[nH]c(=O)oc23)[C@@H](c2c(F)cc(N3CC4(CN(CCF)C4)C3)cc2F)N1CC(F)(F)F |
| InChI | InChI=1S/C26H26F6N4O2/c1-14-6-17-16(2-3-20-23(17)38-24(37)33-20)22(36(14)13-26(30,31)32)21-18(28)7-15(8-19(21)29)35-11-25(12-35)9-34(10-25)5-4-27/h2-3,7-8,14,22H,4-6,9-13H2,1H3,(H,33,37)/t14-,22+/m1/s1 |
| InChIKey | IUFDXTNXXSKWHJ-PEBXRYMYSA-N |
| XLogP | 4.39 |
| TPSA | 55.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|