C43H37F5N4O4 — CID 175326200
4-[3,5-difluoro-4-[(6S,8R)-8-methyl-2-oxo-7-(2,2,2-trifluoroethyl)-3-trityl-8,9-dihydro-6H-[1,3]oxazolo[5,4-f]isoquinolin-6-yl]phenyl]piperazine-1-carboxylic acid (PubChem CID 175326200) has the molecular formula C43H37F5N4O4 and a molecular weight of 768.78 g/mol. Its IUPAC name is 4-[3,5-difluoro-4-[(6S,8R)-8-methyl-2-oxo-7-(2,2,2-trifluoroethyl)-3-trityl-8,9-dihydro-6H-[1,3]oxazolo[5,4-f]isoquinolin-6-yl]phenyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[3,5-difluoro-4-[(6S,8R)-8-methyl-2-oxo-7-(2,2,2-trifluoroethyl)-3-trityl-8,9-dihydro-6H-[1,3]oxazolo[5,4-f]isoquinolin-6-yl]phenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 175326200 |
| Molecular Formula | C43H37F5N4O4 |
| Molecular Weight | 768.78 g/mol |
| Exact Mass | 768.27 |
| IUPAC Name | 4-[3,5-difluoro-4-[(6S,8R)-8-methyl-2-oxo-7-(2,2,2-trifluoroethyl)-3-trityl-8,9-dihydro-6H-[1,3]oxazolo[5,4-f]isoquinolin-6-yl]phenyl]piperazine-1-carboxylic acid |
| SMILES | C[C@@H]1Cc2c(ccc3c2oc(=O)n3C(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](c2c(F)cc(N3CCN(C(=O)O)CC3)cc2F)N1CC(F)(F)F |
| InChI | InChI=1S/C43H37F5N4O4/c1-27-23-33-32(38(51(27)26-42(46,47)48)37-34(44)24-31(25-35(37)45)49-19-21-50(22-20-49)40(53)54)17-18-36-39(33)56-41(55)52(36)43(28-11-5-2-6-12-28,29-13-7-3-8-14-29)30-15-9-4-10-16-30/h2-18,24-25,27,38H,19-23,26H2,1H3,(H,53,54)/t27-,38+/m1/s1 |
| InChIKey | FZUOYLMRBOPHCJ-CWRQMEKBSA-N |
| XLogP | 8.41 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.78 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|