C26H27F6NO5S — CID 135356442
(E)-3-[3,5-difluoro-4-[(1R,3S)-2-(2-fluoro-2-methylpropyl)-3,5-dimethyl-6-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 135356442) has the molecular formula C26H27F6NO5S and a molecular weight of 579.56 g/mol. Its IUPAC name is (E)-3-[3,5-difluoro-4-[(1R,3S)-2-(2-fluoro-2-methylpropyl)-3,5-dimethyl-6-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[3,5-difluoro-4-[(1R,3S)-2-(2-fluoro-2-methylpropyl)-3,5-dimethyl-6-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 135356442 |
| Molecular Formula | C26H27F6NO5S |
| Molecular Weight | 579.56 g/mol |
| Exact Mass | 579.15 |
| IUPAC Name | (E)-3-[3,5-difluoro-4-[(1R,3S)-2-(2-fluoro-2-methylpropyl)-3,5-dimethyl-6-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | C/C(=C\c1cc(F)c([C@H]2c3ccc(OS(=O)(=O)C(F)(F)F)c(C)c3C[C@H](C)N2CC(C)(C)F)c(F)c1)C(=O)O |
| InChI | InChI=1S/C26H27F6NO5S/c1-13(24(34)35)8-16-10-19(27)22(20(28)11-16)23-17-6-7-21(38-39(36,37)26(30,31)32)15(3)18(17)9-14(2)33(23)12-25(4,5)29/h6-8,10-11,14,23H,9,12H2,1-5H3,(H,34,35)/b13-8+/t14-,23+/m0/s1 |
| InChIKey | LFGBMXYHMSVEJP-JMPQDATISA-N |
| XLogP | 6.07 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.56 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|