C26H30F3N5O2 — CID 145208315
methyl (E)-3-[3,5-difluoro-4-[2-(2-fluoro-2-methylpropyl)-3-methyl-6-[(Z)-N'-(methyldiazenyl)carbamimidoyl]-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]prop-2-enoate (PubChem CID 145208315) has the molecular formula C26H30F3N5O2 and a molecular weight of 501.55 g/mol. Its IUPAC name is methyl (E)-3-[3,5-difluoro-4-[2-(2-fluoro-2-methylpropyl)-3-methyl-6-[(Z)-N'-(methyldiazenyl)carbamimidoyl]-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3,5-difluoro-4-[2-(2-fluoro-2-methylpropyl)-3-methyl-6-[(Z)-N'-(methyldiazenyl)carbamimidoyl]-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 145208315 |
| Molecular Formula | C26H30F3N5O2 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | methyl (E)-3-[3,5-difluoro-4-[2-(2-fluoro-2-methylpropyl)-3-methyl-6-[(Z)-N'-(methyldiazenyl)carbamimidoyl]-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]prop-2-enoate |
| SMILES | C/N=N/N=C(\N)c1ccc2c(c1)CC(C)N(CC(C)(C)F)C2c1c(F)cc(/C=C/C(=O)OC)cc1F |
| InChI | InChI=1S/C26H30F3N5O2/c1-15-10-18-13-17(25(30)32-33-31-4)7-8-19(18)24(34(15)14-26(2,3)29)23-20(27)11-16(12-21(23)28)6-9-22(35)36-5/h6-9,11-13,15,24H,10,14H2,1-5H3,(H2,30,31,32)/b9-6+ |
| InChIKey | RXGHWNDTALDSHD-RMKNXTFCSA-N |
| XLogP | 4.94 |
| TPSA | 92.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|