C25H29F3N5O2+ — CID 145208257
[(aminodiazenyl)-[1-[2,6-difluoro-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl]methylidene]azanium (PubChem CID 145208257) has the molecular formula C25H29F3N5O2+ and a molecular weight of 488.53 g/mol. Its IUPAC name is [(aminodiazenyl)-[1-[2,6-difluoro-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl]methylidene]azanium.
| Compound Name | [(aminodiazenyl)-[1-[2,6-difluoro-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl]methylidene]azanium |
|---|---|
| PubChem CID | 145208257 |
| Molecular Formula | C25H29F3N5O2+ |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | [(aminodiazenyl)-[1-[2,6-difluoro-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl]methylidene]azanium |
| SMILES | COC(=O)/C=C/c1cc(F)c(C2c3ccc(C(=[NH2+])/N=N/N)cc3CC(C)N2CC(C)(C)F)c(F)c1 |
| InChI | InChI=1S/C25H28F3N5O2/c1-14-9-17-12-16(24(29)31-32-30)6-7-18(17)23(33(14)13-25(2,3)28)22-19(26)10-15(11-20(22)27)5-8-21(34)35-4/h5-8,10-12,14,23H,9,13H2,1-4H3,(H3,29,30,31)/p+1/b8-5+ |
| InChIKey | OZFFJWAGJZGNIC-VMPITWQZSA-O |
| XLogP | 3.07 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|