C26H28F3NO4 — CID 134610861
methyl (E)-3-[3,5-difluoro-4-[(6R,8S)-7-(2-fluoro-2-methylpropyl)-8-methyl-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinolin-6-yl]phenyl]prop-2-enoate (PubChem CID 134610861) has the molecular formula C26H28F3NO4 and a molecular weight of 475.51 g/mol. Its IUPAC name is methyl (E)-3-[3,5-difluoro-4-[(6R,8S)-7-(2-fluoro-2-methylpropyl)-8-methyl-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinolin-6-yl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3,5-difluoro-4-[(6R,8S)-7-(2-fluoro-2-methylpropyl)-8-methyl-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinolin-6-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 134610861 |
| Molecular Formula | C26H28F3NO4 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | methyl (E)-3-[3,5-difluoro-4-[(6R,8S)-7-(2-fluoro-2-methylpropyl)-8-methyl-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinolin-6-yl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc(F)c([C@H]2c3cc4c(cc3C[C@H](C)N2CC(C)(C)F)OCCO4)c(F)c1 |
| InChI | InChI=1S/C26H28F3NO4/c1-15-9-17-12-21-22(34-8-7-33-21)13-18(17)25(30(15)14-26(2,3)29)24-19(27)10-16(11-20(24)28)5-6-23(31)32-4/h5-6,10-13,15,25H,7-9,14H2,1-4H3/b6-5+/t15-,25+/m0/s1 |
| InChIKey | YYDJDTVNLJDVKY-HBCTWDGESA-N |
| XLogP | 5.01 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|