C24H26F3NO4 — CID 135134232
3-[3,5-difluoro-4-[(5R,7S)-6-(2-fluoro-2-methylpropyl)-7-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]phenyl]propanoic acid (PubChem CID 135134232) has the molecular formula C24H26F3NO4 and a molecular weight of 449.47 g/mol. Its IUPAC name is 3-[3,5-difluoro-4-[(5R,7S)-6-(2-fluoro-2-methylpropyl)-7-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]phenyl]propanoic acid.
| Compound Name | 3-[3,5-difluoro-4-[(5R,7S)-6-(2-fluoro-2-methylpropyl)-7-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 135134232 |
| Molecular Formula | C24H26F3NO4 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 3-[3,5-difluoro-4-[(5R,7S)-6-(2-fluoro-2-methylpropyl)-7-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]phenyl]propanoic acid |
| SMILES | C[C@H]1Cc2cc3c(cc2[C@H](c2c(F)cc(CCC(=O)O)cc2F)N1CC(C)(C)F)OCO3 |
| InChI | InChI=1S/C24H26F3NO4/c1-13-6-15-9-19-20(32-12-31-19)10-16(15)23(28(13)11-24(2,3)27)22-17(25)7-14(8-18(22)26)4-5-21(29)30/h7-10,13,23H,4-6,11-12H2,1-3H3,(H,29,30)/t13-,23+/m0/s1 |
| InChIKey | UMXURZHBPWTJGM-ZAMGYDSWSA-N |
| XLogP | 4.79 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |