C29H34F3NO2Si — CID 140879497
methyl (E)-3-[3,5-difluoro-4-[2-(2-fluoro-2-methylpropyl)-3-methyl-6-(2-trimethylsilylethynyl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]prop-2-enoate (PubChem CID 140879497) has the molecular formula C29H34F3NO2Si and a molecular weight of 513.68 g/mol. Its IUPAC name is methyl (E)-3-[3,5-difluoro-4-[2-(2-fluoro-2-methylpropyl)-3-methyl-6-(2-trimethylsilylethynyl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3,5-difluoro-4-[2-(2-fluoro-2-methylpropyl)-3-methyl-6-(2-trimethylsilylethynyl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 140879497 |
| Molecular Formula | C29H34F3NO2Si |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | methyl (E)-3-[3,5-difluoro-4-[2-(2-fluoro-2-methylpropyl)-3-methyl-6-(2-trimethylsilylethynyl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc(F)c(C2c3ccc(C#C[Si](C)(C)C)cc3CC(C)N2CC(C)(C)F)c(F)c1 |
| InChI | InChI=1S/C29H34F3NO2Si/c1-19-14-22-15-20(12-13-36(5,6)7)8-10-23(22)28(33(19)18-29(2,3)32)27-24(30)16-21(17-25(27)31)9-11-26(34)35-4/h8-11,15-17,19,28H,14,18H2,1-7H3/b11-9+ |
| InChIKey | XCXNFJZOXFDKQI-PKNBQFBNSA-N |
| XLogP | 6.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|