C22H19F5N2 — CID 166473299
(4S,6S)-6-(2,6-difluorophenyl)-4-methyl-5-(2,2,2-trifluoroethyl)-5,8-diazatetracyclo[7.6.0.02,7.011,14]pentadeca-1(9),2(7),10,14-tetraene (PubChem CID 166473299) has the molecular formula C22H19F5N2 and a molecular weight of 406.40 g/mol. Its IUPAC name is (4S,6S)-6-(2,6-difluorophenyl)-4-methyl-5-(2,2,2-trifluoroethyl)-5,8-diazatetracyclo[7.6.0.02,7.011,14]pentadeca-1(9),2(7),10,14-tetraene.
| Compound Name | (4S,6S)-6-(2,6-difluorophenyl)-4-methyl-5-(2,2,2-trifluoroethyl)-5,8-diazatetracyclo[7.6.0.02,7.011,14]pentadeca-1(9),2(7),10,14-tetraene |
|---|---|
| PubChem CID | 166473299 |
| Molecular Formula | C22H19F5N2 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (4S,6S)-6-(2,6-difluorophenyl)-4-methyl-5-(2,2,2-trifluoroethyl)-5,8-diazatetracyclo[7.6.0.02,7.011,14]pentadeca-1(9),2(7),10,14-tetraene |
| SMILES | C[C@H]1Cc2c([nH]c3cc4c(cc23)CC4)[C@H](c2c(F)cccc2F)N1CC(F)(F)F |
| InChI | InChI=1S/C22H19F5N2/c1-11-7-15-14-8-12-5-6-13(12)9-18(14)28-20(15)21(29(11)10-22(25,26)27)19-16(23)3-2-4-17(19)24/h2-4,8-9,11,21,28H,5-7,10H2,1H3/t11-,21-/m0/s1 |
| InChIKey | IAATWPAKPXCOTR-MQJDWESPSA-N |
| XLogP | 5.44 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|