C25H26F5N3O — CID 175054290
(6S,8R)-6-[4-(cyclopentylmethoxy)-2,6-difluorophenyl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline (PubChem CID 175054290) has the molecular formula C25H26F5N3O and a molecular weight of 479.49 g/mol. Its IUPAC name is (6S,8R)-6-[4-(cyclopentylmethoxy)-2,6-difluorophenyl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline.
| Compound Name | (6S,8R)-6-[4-(cyclopentylmethoxy)-2,6-difluorophenyl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline |
|---|---|
| PubChem CID | 175054290 |
| Molecular Formula | C25H26F5N3O |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | (6S,8R)-6-[4-(cyclopentylmethoxy)-2,6-difluorophenyl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline |
| SMILES | C[C@@H]1Cc2c(ccc3[nH]ncc23)[C@@H](c2c(F)cc(OCC3CCCC3)cc2F)N1CC(F)(F)F |
| InChI | InChI=1S/C25H26F5N3O/c1-14-8-18-17(6-7-22-19(18)11-31-32-22)24(33(14)13-25(28,29)30)23-20(26)9-16(10-21(23)27)34-12-15-4-2-3-5-15/h6-7,9-11,14-15,24H,2-5,8,12-13H2,1H3,(H,31,32)/t14-,24+/m1/s1 |
| InChIKey | KYMVVWRGSYMJJH-SHACYNPGSA-N |
| XLogP | 6.31 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |