C25H27Cl2N3O4S — CID 146520315
N-[4-[2-[4-[2-[3-chloro-4-(3-chloropropoxy)-5-cyanophenyl]propan-2-yl]phenyl]ethyl]-1,3-oxazol-2-yl]methanesulfonamide (PubChem CID 146520315) has the molecular formula C25H27Cl2N3O4S and a molecular weight of 536.48 g/mol. Its IUPAC name is N-[4-[2-[4-[2-[3-chloro-4-(3-chloropropoxy)-5-cyanophenyl]propan-2-yl]phenyl]ethyl]-1,3-oxazol-2-yl]methanesulfonamide.
| Compound Name | N-[4-[2-[4-[2-[3-chloro-4-(3-chloropropoxy)-5-cyanophenyl]propan-2-yl]phenyl]ethyl]-1,3-oxazol-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 146520315 |
| Molecular Formula | C25H27Cl2N3O4S |
| Molecular Weight | 536.48 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | N-[4-[2-[4-[2-[3-chloro-4-(3-chloropropoxy)-5-cyanophenyl]propan-2-yl]phenyl]ethyl]-1,3-oxazol-2-yl]methanesulfonamide |
| SMILES | CC(C)(c1ccc(CCc2coc(NS(C)(=O)=O)n2)cc1)c1cc(Cl)c(OCCCCl)c(C#N)c1 |
| InChI | InChI=1S/C25H27Cl2N3O4S/c1-25(2,20-13-18(15-28)23(22(27)14-20)33-12-4-11-26)19-8-5-17(6-9-19)7-10-21-16-34-24(29-21)30-35(3,31)32/h5-6,8-9,13-14,16H,4,7,10-12H2,1-3H3,(H,29,30) |
| InChIKey | SHZUXFQWUQPCPX-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|