C26H30ClN3O4S — CID 159694793
N-[4-[2-[4-[2-(4-butoxy-3-chloro-5-cyanophenyl)propan-2-yl]phenyl]ethyl]-1,3-oxazol-2-yl]methanesulfonamide (PubChem CID 159694793) has the molecular formula C26H30ClN3O4S and a molecular weight of 516.06 g/mol. Its IUPAC name is N-[4-[2-[4-[2-(4-butoxy-3-chloro-5-cyanophenyl)propan-2-yl]phenyl]ethyl]-1,3-oxazol-2-yl]methanesulfonamide.
| Compound Name | N-[4-[2-[4-[2-(4-butoxy-3-chloro-5-cyanophenyl)propan-2-yl]phenyl]ethyl]-1,3-oxazol-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 159694793 |
| Molecular Formula | C26H30ClN3O4S |
| Molecular Weight | 516.06 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | N-[4-[2-[4-[2-(4-butoxy-3-chloro-5-cyanophenyl)propan-2-yl]phenyl]ethyl]-1,3-oxazol-2-yl]methanesulfonamide |
| SMILES | CCCCOc1c(Cl)cc(C(C)(C)c2ccc(CCc3coc(NS(C)(=O)=O)n3)cc2)cc1C#N |
| InChI | InChI=1S/C26H30ClN3O4S/c1-5-6-13-33-24-19(16-28)14-21(15-23(24)27)26(2,3)20-10-7-18(8-11-20)9-12-22-17-34-25(29-22)30-35(4,31)32/h7-8,10-11,14-15,17H,5-6,9,12-13H2,1-4H3,(H,29,30) |
| InChIKey | ADAJQXXNCHKQQG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.06 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|