C24H33N3O6 — CID 146524623
2-methoxyethyl N-[(1S)-1-cyclohexyl-2-oxo-2-[(2-oxospiro[1H-indole-3,4'-oxane]-6-yl)amino]ethyl]carbamate (PubChem CID 146524623) has the molecular formula C24H33N3O6 and a molecular weight of 459.54 g/mol. Its IUPAC name is 2-methoxyethyl N-[(1S)-1-cyclohexyl-2-oxo-2-[(2-oxospiro[1H-indole-3,4'-oxane]-6-yl)amino]ethyl]carbamate.
| Compound Name | 2-methoxyethyl N-[(1S)-1-cyclohexyl-2-oxo-2-[(2-oxospiro[1H-indole-3,4'-oxane]-6-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 146524623 |
| Molecular Formula | C24H33N3O6 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 2-methoxyethyl N-[(1S)-1-cyclohexyl-2-oxo-2-[(2-oxospiro[1H-indole-3,4'-oxane]-6-yl)amino]ethyl]carbamate |
| SMILES | COCCOC(=O)N[C@H](C(=O)Nc1ccc2c(c1)NC(=O)C21CCOCC1)C1CCCCC1 |
| InChI | InChI=1S/C24H33N3O6/c1-31-13-14-33-23(30)27-20(16-5-3-2-4-6-16)21(28)25-17-7-8-18-19(15-17)26-22(29)24(18)9-11-32-12-10-24/h7-8,15-16,20H,2-6,9-14H2,1H3,(H,25,28)(H,26,29)(H,27,30)/t20-/m0/s1 |
| InChIKey | WMPWINBZBVRBPG-FQEVSTJZSA-N |
| XLogP | 2.95 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|