C26H31N5O4 — CID 146576218
N-[4-cyclopentyl-1-oxo-1-[(2-oxospiro[1H-indole-3,4'-oxane]-6-yl)amino]but-2-en-2-yl]-2-methylpyrazole-3-carboxamide (PubChem CID 146576218) has the molecular formula C26H31N5O4 and a molecular weight of 477.57 g/mol. Its IUPAC name is N-[4-cyclopentyl-1-oxo-1-[(2-oxospiro[1H-indole-3,4'-oxane]-6-yl)amino]but-2-en-2-yl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[4-cyclopentyl-1-oxo-1-[(2-oxospiro[1H-indole-3,4'-oxane]-6-yl)amino]but-2-en-2-yl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146576218 |
| Molecular Formula | C26H31N5O4 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | N-[4-cyclopentyl-1-oxo-1-[(2-oxospiro[1H-indole-3,4'-oxane]-6-yl)amino]but-2-en-2-yl]-2-methylpyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)NC(=CCC1CCCC1)C(=O)Nc1ccc2c(c1)NC(=O)C21CCOCC1 |
| InChI | InChI=1S/C26H31N5O4/c1-31-22(10-13-27-31)24(33)29-20(9-6-17-4-2-3-5-17)23(32)28-18-7-8-19-21(16-18)30-25(34)26(19)11-14-35-15-12-26/h7-10,13,16-17H,2-6,11-12,14-15H2,1H3,(H,28,32)(H,29,33)(H,30,34) |
| InChIKey | DVCFJWXQCWGJLL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|