C23H30N2O5 — CID 146524632
ethyl 2-cyclohexyl-3-oxo-3-[(2-oxospiro[1H-indole-3,4'-oxane]-6-yl)amino]propanoate (PubChem CID 146524632) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is ethyl 2-cyclohexyl-3-oxo-3-[(2-oxospiro[1H-indole-3,4'-oxane]-6-yl)amino]propanoate.
| Compound Name | ethyl 2-cyclohexyl-3-oxo-3-[(2-oxospiro[1H-indole-3,4'-oxane]-6-yl)amino]propanoate |
|---|---|
| PubChem CID | 146524632 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | ethyl 2-cyclohexyl-3-oxo-3-[(2-oxospiro[1H-indole-3,4'-oxane]-6-yl)amino]propanoate |
| SMILES | CCOC(=O)C(C(=O)Nc1ccc2c(c1)NC(=O)C21CCOCC1)C1CCCCC1 |
| InChI | InChI=1S/C23H30N2O5/c1-2-30-21(27)19(15-6-4-3-5-7-15)20(26)24-16-8-9-17-18(14-16)25-22(28)23(17)10-12-29-13-11-23/h8-9,14-15,19H,2-7,10-13H2,1H3,(H,24,26)(H,25,28) |
| InChIKey | MFJYJFHDOHWEEJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|