C18H18Cl2F3N5O3S — CID 146525785
2-[(3R)-4,4-dichloro-3-methylpiperidin-1-yl]-N-(2-sulfamoyl-4-pyridinyl)-5-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 146525785) has the molecular formula C18H18Cl2F3N5O3S and a molecular weight of 512.34 g/mol. Its IUPAC name is 2-[(3R)-4,4-dichloro-3-methylpiperidin-1-yl]-N-(2-sulfamoyl-4-pyridinyl)-5-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-[(3R)-4,4-dichloro-3-methylpiperidin-1-yl]-N-(2-sulfamoyl-4-pyridinyl)-5-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 146525785 |
| Molecular Formula | C18H18Cl2F3N5O3S |
| Molecular Weight | 512.34 g/mol |
| Exact Mass | 511.05 |
| IUPAC Name | 2-[(3R)-4,4-dichloro-3-methylpiperidin-1-yl]-N-(2-sulfamoyl-4-pyridinyl)-5-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | C[C@@H]1CN(c2ncc(C(F)(F)F)cc2C(=O)Nc2ccnc(S(N)(=O)=O)c2)CCC1(Cl)Cl |
| InChI | InChI=1S/C18H18Cl2F3N5O3S/c1-10-9-28(5-3-17(10,19)20)15-13(6-11(8-26-15)18(21,22)23)16(29)27-12-2-4-25-14(7-12)32(24,30)31/h2,4,6-8,10H,3,5,9H2,1H3,(H2,24,30,31)(H,25,27,29)/t10-/m1/s1 |
| InChIKey | JAJARTJMNILVIN-SNVBAGLBSA-N |
| XLogP | 3.42 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|