C21H21ClFN5O — CID 146528074
4-[2-(4-amino-2-chloro-6-fluorophenoxy)-3-pyridinyl]-N-cyclohexylpyrimidin-2-amine (PubChem CID 146528074) has the molecular formula C21H21ClFN5O and a molecular weight of 413.88 g/mol. Its IUPAC name is 4-[2-(4-amino-2-chloro-6-fluorophenoxy)-3-pyridinyl]-N-cyclohexylpyrimidin-2-amine.
| Compound Name | 4-[2-(4-amino-2-chloro-6-fluorophenoxy)-3-pyridinyl]-N-cyclohexylpyrimidin-2-amine |
|---|---|
| PubChem CID | 146528074 |
| Molecular Formula | C21H21ClFN5O |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 4-[2-(4-amino-2-chloro-6-fluorophenoxy)-3-pyridinyl]-N-cyclohexylpyrimidin-2-amine |
| SMILES | Nc1cc(F)c(Oc2ncccc2-c2ccnc(NC3CCCCC3)n2)c(Cl)c1 |
| InChI | InChI=1S/C21H21ClFN5O/c22-16-11-13(24)12-17(23)19(16)29-20-15(7-4-9-25-20)18-8-10-26-21(28-18)27-14-5-2-1-3-6-14/h4,7-12,14H,1-3,5-6,24H2,(H,26,27,28) |
| InChIKey | YRMIUXFCCKTARI-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|