3-(2,3-dihydroindol-1-ylsulfinyl)benzoic acid

C15H13NO3S — CID 146529052

IUPAC3-(2,3-dihydroindol-1-ylsulfinyl)benzoic acid
SMILESO=C(O)c1cccc(S(=O)N2CCc3ccccc32)c1
InChIInChI=1S/C15H13NO3S/c17-15(18)12-5-3-6-13(10-12)20(19)16-9-8-11-4-1-2-7-14(11)16/h1-7,10H,8-9H2,(H,17,18)
InChIKeyQLZWDHOMNHIOCI-UHFFFAOYSA-N
MW287.34 g/mol
LogP2.47
Rot. Bonds3

About 3-(2,3-dihydroindol-1-ylsulfinyl)benzoic acid

3-(2,3-dihydroindol-1-ylsulfinyl)benzoic acid (PubChem CID 146529052) has the molecular formula C15H13NO3S and a molecular weight of 287.34 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-ylsulfinyl)benzoic acid.

Molecular Properties

Compound Name3-(2,3-dihydroindol-1-ylsulfinyl)benzoic acid
PubChem CID146529052
Molecular FormulaC15H13NO3S
Molecular Weight287.34 g/mol
Exact Mass287.06
IUPAC Name3-(2,3-dihydroindol-1-ylsulfinyl)benzoic acid
SMILESO=C(O)c1cccc(S(=O)N2CCc3ccccc32)c1
InChIInChI=1S/C15H13NO3S/c17-15(18)12-5-3-6-13(10-12)20(19)16-9-8-11-4-1-2-7-14(11)16/h1-7,10H,8-9H2,(H,17,18)
InChIKeyQLZWDHOMNHIOCI-UHFFFAOYSA-N
XLogP2.47
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.34
LogP ≤ 52.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(2,3-dihydroindol-1-ylsulfinyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,3-dihydroindol-1-ylsulfinyl)benzoic acid?
The IUPAC name of 3-(2,3-dihydroindol-1-ylsulfinyl)benzoic acid (CID 146529052) is 3-(2,3-dihydroindol-1-ylsulfinyl)benzoic acid.
What is the SMILES notation for 3-(2,3-dihydroindol-1-ylsulfinyl)benzoic acid?
The canonical SMILES for 3-(2,3-dihydroindol-1-ylsulfinyl)benzoic acid is O=C(O)c1cccc(S(=O)N2CCc3ccccc32)c1.
What is the InChIKey of 3-(2,3-dihydroindol-1-ylsulfinyl)benzoic acid?
The InChIKey is QLZWDHOMNHIOCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO3S/c17-15(18)12-5-3-6-13(10-12)20(19)16-9-8-11-4-1-2-7-14(11)16/h1-7,10H,8-9H2,(H,17,18).
What are the key properties of 3-(2,3-dihydroindol-1-ylsulfinyl)benzoic acid?
3-(2,3-dihydroindol-1-ylsulfinyl)benzoic acid has a molecular weight of 287.34 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydroindol-1-ylsulfinyl)benzoic acid is sourced from PubChem (CID 146529052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).