C25H28FN3O4S — CID 146530151
[1-(3-fluorophenyl)cyclopropyl]-[5-[(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methanone (PubChem CID 146530151) has the molecular formula C25H28FN3O4S and a molecular weight of 485.58 g/mol. Its IUPAC name is [1-(3-fluorophenyl)cyclopropyl]-[5-[(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methanone.
| Compound Name | [1-(3-fluorophenyl)cyclopropyl]-[5-[(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methanone |
|---|---|
| PubChem CID | 146530151 |
| Molecular Formula | C25H28FN3O4S |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | [1-(3-fluorophenyl)cyclopropyl]-[5-[(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methanone |
| SMILES | CN1CCOc2ccc(S(=O)(=O)N3CC4CN(C(=O)C5(c6cccc(F)c6)CC5)CC4C3)cc21 |
| InChI | InChI=1S/C25H28FN3O4S/c1-27-9-10-33-23-6-5-21(12-22(23)27)34(31,32)29-15-17-13-28(14-18(17)16-29)24(30)25(7-8-25)19-3-2-4-20(26)11-19/h2-6,11-12,17-18H,7-10,13-16H2,1H3 |
| InChIKey | FYNIUBHPFBBAJI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |