C23H20FN3O2S — CID 146531681
N-[4-[3-[2-[(5-cyclopropyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]phenyl]-2-fluorophenyl]prop-2-enamide (PubChem CID 146531681) has the molecular formula C23H20FN3O2S and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[4-[3-[2-[(5-cyclopropyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]phenyl]-2-fluorophenyl]prop-2-enamide.
| Compound Name | N-[4-[3-[2-[(5-cyclopropyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]phenyl]-2-fluorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146531681 |
| Molecular Formula | C23H20FN3O2S |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | N-[4-[3-[2-[(5-cyclopropyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]phenyl]-2-fluorophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(-c2cccc(CC(=O)Nc3ncc(C4CC4)s3)c2)cc1F |
| InChI | InChI=1S/C23H20FN3O2S/c1-2-21(28)26-19-9-8-17(12-18(19)24)16-5-3-4-14(10-16)11-22(29)27-23-25-13-20(30-23)15-6-7-15/h2-5,8-10,12-13,15H,1,6-7,11H2,(H,26,28)(H,25,27,29) |
| InChIKey | ZZMNYZLFKVZUEM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|