C18H21F2NO3P2 — CID 146533416
[1,1-bis(4-fluorophenyl)-1-hydroxypropan-2-yl] 2-[bis(phosphanyl)amino]propanoate (PubChem CID 146533416) has the molecular formula C18H21F2NO3P2 and a molecular weight of 399.31 g/mol. Its IUPAC name is [1,1-bis(4-fluorophenyl)-1-hydroxypropan-2-yl] 2-[bis(phosphanyl)amino]propanoate.
| Compound Name | [1,1-bis(4-fluorophenyl)-1-hydroxypropan-2-yl] 2-[bis(phosphanyl)amino]propanoate |
|---|---|
| PubChem CID | 146533416 |
| Molecular Formula | C18H21F2NO3P2 |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | [1,1-bis(4-fluorophenyl)-1-hydroxypropan-2-yl] 2-[bis(phosphanyl)amino]propanoate |
| SMILES | CC(C(=O)OC(C)C(O)(c1ccc(F)cc1)c1ccc(F)cc1)N(P)P |
| InChI | InChI=1S/C18H21F2NO3P2/c1-11(21(25)26)17(22)24-12(2)18(23,13-3-7-15(19)8-4-13)14-5-9-16(20)10-6-14/h3-12,23H,25-26H2,1-2H3 |
| InChIKey | WOZJKAXFWRSQCK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|