C18H18F2O3 — CID 155110586
[(2S)-1,1-bis(4-fluorophenyl)-1-hydroxypropan-2-yl] propanoate (PubChem CID 155110586) has the molecular formula C18H18F2O3 and a molecular weight of 320.34 g/mol. Its IUPAC name is [(2S)-1,1-bis(4-fluorophenyl)-1-hydroxypropan-2-yl] propanoate.
| Compound Name | [(2S)-1,1-bis(4-fluorophenyl)-1-hydroxypropan-2-yl] propanoate |
|---|---|
| PubChem CID | 155110586 |
| Molecular Formula | C18H18F2O3 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | [(2S)-1,1-bis(4-fluorophenyl)-1-hydroxypropan-2-yl] propanoate |
| SMILES | CCC(=O)O[C@@H](C)C(O)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H18F2O3/c1-3-17(21)23-12(2)18(22,13-4-8-15(19)9-5-13)14-6-10-16(20)11-7-14/h4-12,22H,3H2,1-2H3/t12-/m0/s1 |
| InChIKey | KRKPCPLVRIZNIM-LBPRGKRZSA-N |
| XLogP | 3.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |