C19H32N2O2S — CID 146534741
tert-butyl 4-[(1R)-3-[2-(trimethyl-λ4-sulfanyl)ethynyl]cyclopent-2-en-1-yl]piperazine-1-carboxylate (PubChem CID 146534741) has the molecular formula C19H32N2O2S and a molecular weight of 352.54 g/mol. Its IUPAC name is tert-butyl 4-[(1R)-3-[2-(trimethyl-λ4-sulfanyl)ethynyl]cyclopent-2-en-1-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1R)-3-[2-(trimethyl-λ4-sulfanyl)ethynyl]cyclopent-2-en-1-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 146534741 |
| Molecular Formula | C19H32N2O2S |
| Molecular Weight | 352.54 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | tert-butyl 4-[(1R)-3-[2-(trimethyl-λ4-sulfanyl)ethynyl]cyclopent-2-en-1-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@H]2C=C(C#CS(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C19H32N2O2S/c1-19(2,3)23-18(22)21-12-10-20(11-13-21)17-8-7-16(15-17)9-14-24(4,5)6/h15,17H,7-8,10-13H2,1-6H3/t17-/m1/s1 |
| InChIKey | JRWFNIUDUOCKBV-QGZVFWFLSA-N |
| XLogP | 3.28 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|